|
CAS#: 16587-41-0 Product: 3,7-Dimethylbenzo[b]Thiophene No suppilers available for the product. |
| Name | 3,7-Dimethylbenzo[b]Thiophene |
|---|---|
| Synonyms | 3,7-Dimethylbenzothiophene; Benzo(B)Thiophene, 3,7-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10S |
| Molecular Weight | 162.25 |
| CAS Registry Number | 16587-41-0 |
| SMILES | C1=C(C)C2=C(S1)C(=CC=C2)C |
| InChI | 1S/C10H10S/c1-7-4-3-5-9-8(2)6-11-10(7)9/h3-6H,1-2H3 |
| InChIKey | YFVIULBUVVXJQI-UHFFFAOYSA-N |
| Density | 1.115g/cm3 (Cal.) |
|---|---|
| Boiling point | 264.911°C at 760 mmHg (Cal.) |
| Flash point | 82.795°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7-Dimethylbenzo[b]Thiophene |