|
CAS#: 1659-95-6 Product: Dimethyl 1,3-Cyclohexadiene-1,4-Dicarboxylate No suppilers available for the product. |
| Name | Dimethyl 1,3-Cyclohexadiene-1,4-Dicarboxylate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 |
| CAS Registry Number | 1659-95-6 |
| SMILES | O=C(OC)\C1=C\C=C(\C(=O)OC)CC1 |
| InChI | 1S/C10H12O4/c1-13-9(11)7-3-5-8(6-4-7)10(12)14-2/h3,5H,4,6H2,1-2H3 |
| InChIKey | OHMZFZHWICZJNJ-UHFFFAOYSA-N |
| Density | 1.195g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.04°C at 760 mmHg (Cal.) |
| Flash point | 139.951°C (Cal.) |
| Refractive index | 1.506 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dimethyl 1,3-Cyclohexadiene-1,4-Dicarboxylate |