|
CAS#: 16603-16-0 Product: 1-(4-Isopropyl-alpha-Methylphenethyl)Hydrazine No suppilers available for the product. |
| Name | 1-(4-Isopropyl-alpha-Methylphenethyl)Hydrazine |
|---|---|
| Synonyms | [2-(4-Isopropylphenyl)-1-Methyl-Ethyl]Hydrazine; [2-(4-Isopropylphenyl)-1-Methylethyl]Hydrazine; 1-(P-Isopropyl-Alpha-Methyl)Phenethylhydrazine |
| Molecular Structure | ![]() |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.30 |
| CAS Registry Number | 16603-16-0 |
| SMILES | C1=C(C=CC(=C1)C(C)C)CC(NN)C |
| InChI | 1S/C12H20N2/c1-9(2)12-6-4-11(5-7-12)8-10(3)14-13/h4-7,9-10,14H,8,13H2,1-3H3 |
| InChIKey | PVNRNJYIJJGSRB-UHFFFAOYSA-N |
| Density | 0.953g/cm3 (Cal.) |
|---|---|
| Boiling point | 325.188°C at 760 mmHg (Cal.) |
| Flash point | 176.08°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(4-Isopropyl-alpha-Methylphenethyl)Hydrazine |