|
CAS#: 16635-14-6 Product: 1-(2-Hydroxyphenyl)-3-(4-Methylphenyl)-2-Propen-1-One No suppilers available for the product. |
| Name | 1-(2-Hydroxyphenyl)-3-(4-Methylphenyl)-2-Propen-1-One |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.28 |
| CAS Registry Number | 16635-14-6 |
| SMILES | O=C(c1ccccc1O)C=Cc2ccc(cc2)C |
| InChI | 1S/C16H14O2/c1-12-6-8-13(9-7-12)10-11-16(18)14-4-2-3-5-15(14)17/h2-11,17H,1H3 |
| InChIKey | OOEWKJHFFYCQBM-UHFFFAOYSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 410.484°C at 760 mmHg (Cal.) |
| Flash point | 175.257°C (Cal.) |
| Refractive index | 1.641 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Hydroxyphenyl)-3-(4-Methylphenyl)-2-Propen-1-One |