|
CAS#: 16641-30-8 Product: 4,7-Dichloro-4,7-dimethyl-1-propan-2-yl-1,2,3,4a,5,6,8,8a-octahydronaphthalene No suppilers available for the product. |
| Name | 4,7-Dichloro-4,7-dimethyl-1-propan-2-yl-1,2,3,4a,5,6,8,8a-octahydronaphthalene |
|---|---|
| Synonyms | 1,6-Dichloro-4-Isopropyl-1,6-Dimethyl-Decalin; 1,6-Dichloro-4-Isopropyl-1,6-Dimethyldecalin; Nsc147748 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H26Cl2 |
| Molecular Weight | 277.28 |
| CAS Registry Number | 16641-30-8 |
| SMILES | CC1(C2C(C(CC1)C(C)C)CC(CC2)(Cl)C)Cl |
| InChI | 1S/C15H26Cl2/c1-10(2)11-5-8-15(4,17)13-6-7-14(3,16)9-12(11)13/h10-13H,5-9H2,1-4H3 |
| InChIKey | MVELFXADPKFEEW-UHFFFAOYSA-N |
| Density | 1.047g/cm3 (Cal.) |
|---|---|
| Boiling point | 338.736°C at 760 mmHg (Cal.) |
| Flash point | 131.6°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,7-Dichloro-4,7-dimethyl-1-propan-2-yl-1,2,3,4a,5,6,8,8a-octahydronaphthalene |