|
CAS#: 166432-53-7 Product: 2-Methyl-4-(2,2,3-Trimethyl-3-Cyclopenten-1-Yl)-4-Pentenal No suppilers available for the product. |
| Name | 2-Methyl-4-(2,2,3-Trimethyl-3-Cyclopenten-1-Yl)-4-Pentenal |
|---|---|
| Synonyms | 3-Cyclopentene-1-butanal, α,2,2,3-tetramethyl-γ-methylene- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H22O |
| Molecular Weight | 206.32 |
| CAS Registry Number | 166432-53-7 |
| SMILES | CC1(C)C(/C)=C\CC1C(=C)CC(C)C=O |
| InChI | 1S/C14H22O/c1-10(9-15)8-11(2)13-7-6-12(3)14(13,4)5/h6,9-10,13H,2,7-8H2,1,3-5H3 |
| InChIKey | IECMPAIBUCFZDR-UHFFFAOYSA-N |
| Density | 0.893g/cm3 (Cal.) |
|---|---|
| Boiling point | 281.396°C at 760 mmHg (Cal.) |
| Flash point | 126.643°C (Cal.) |
| Refractive index | 1.466 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Methyl-4-(2,2,3-Trimethyl-3-Cyclopenten-1-Yl)-4-Pentenal |