|
CAS#: 16654-60-7 Product: Triethyl(2-Phenoxyethoxy)Silane No suppilers available for the product. |
| Name | Triethyl(2-Phenoxyethoxy)Silane |
|---|---|
| Synonyms | Triethyl(2-phenoxyethoxy)silane # |
| Molecular Structure | ![]() |
| Molecular Formula | C14H24O2Si |
| Molecular Weight | 252.42 |
| CAS Registry Number | 16654-60-7 |
| SMILES | O(c1ccccc1)CCO[Si](CC)(CC)CC |
| InChI | 1S/C14H24O2Si/c1-4-17(5-2,6-3)16-13-12-15-14-10-8-7-9-11-14/h7-11H,4-6,12-13H2,1-3H3 |
| InChIKey | ITIOKSHBUBCWBP-UHFFFAOYSA-N |
| Density | 0.931g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.38°C at 760 mmHg (Cal.) |
| Flash point | 108.382°C (Cal.) |
| Refractive index | 1.471 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Triethyl(2-Phenoxyethoxy)Silane |