Online Database of Chemicals from Around the World
|
CAS#: 16661-00-0 Product: 1,2,4,5,8,8a-Hexahydro-6,8a-Dimethyl-3-Isopropylazulene No suppilers available for the product. |
| Name | 1,2,4,5,8,8a-Hexahydro-6,8a-Dimethyl-3-Isopropylazulene |
|---|---|
| Synonyms | 3-Isopropyl-6,8A-Dimethyl-2,4,5,8-Tetrahydro-1H-Azulene; Daucene; Dauca-4,8-Diene (Daucene) |
| Molecular Structure |  |
| Molecular Formula | C15H24 |
| Molecular Weight | 204.35 |
| CAS Registry Number | 16661-00-0 |
| SMILES | CC12C(=C(CC1)C(C)C)CCC(=CC2)C |
| InChI | 1S/C15H24/c1-11(2)13-8-10-15(4)9-7-12(3)5-6-14(13)15/h7,11H,5-6,8-10H2,1-4H3 |
| InChIKey | MGMBZNCFUFRSSP-UHFFFAOYSA-N |
| Density | 0.905g/cm3 (Cal.) |
|---|---|
| Boiling point | 276.301°C at 760 mmHg (Cal.) |
| Flash point | 108.82°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,4,5,8,8a-Hexahydro-6,8a-Dimethyl-3-Isopropylazulene |