Online Database of Chemicals from Around the World
|
CAS#: 16664-32-7 Product: 3-(Adamantan-1-Yl)-1-(2-Methyl-2-Propanyl)-2-Aziridinone No suppilers available for the product. |
| Name | 3-(Adamantan-1-Yl)-1-(2-Methyl-2-Propanyl)-2-Aziridinone |
|---|---|
| Synonyms | 1-Adamantyl-3-tert-butyl-2-aziridinone; 2-Aziridinone, 1-(1-adamantyl)-3-tert-butyl- |
| Molecular Structure |  |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 |
| CAS Registry Number | 16664-32-7 |
| SMILES | O=C1N(C(C)(C)C)C1C34CC2CC(CC(C2)C3)C4 |
| InChI | 1S/C16H25NO/c1-15(2,3)17-13(14(17)18)16-7-10-4-11(8-16)6-12(5-10)9-16/h10-13H,4-9H2,1-3H3 |
| InChIKey | HLNNBVDMNAJDCE-UHFFFAOYSA-N |
| Density | 1.151g/cm3 (Cal.) |
|---|---|
| Boiling point | 322.566°C at 760 mmHg (Cal.) |
| Flash point | 134.021°C (Cal.) |
| Refractive index | 1.578 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Adamantan-1-Yl)-1-(2-Methyl-2-Propanyl)-2-Aziridinone |