| Name | Dibutylammonium Trihydrogen Diphosphorate |
|---|---|
| Synonyms | Dibutylamine; Phosphono Dihydrogen Phosphate; Diphosphoric Acid, Compound With Dibutylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C8H23NO7P2 |
| Molecular Weight | 307.22 |
| CAS Registry Number | 16687-06-2 |
| EINECS | 261-804-7 |
| SMILES | O=[P](O[P](=O)(O)O)(O)O.C(NCCCC)CCC |
| InChI | 1S/C8H19N.H4O7P2/c1-3-5-7-9-8-6-4-2;1-8(2,3)7-9(4,5)6/h9H,3-8H2,1-2H3;(H2,1,2,3)(H2,4,5,6) |
| InChIKey | GFFBAXKJVPVOAP-UHFFFAOYSA-N |
| Boiling point | 163°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 41.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dibutylammonium Trihydrogen Diphosphorate |