|
CAS#: 16688-88-3 Product: 2,5-Bis(4-Hydroxyphenyl)-1,4-Benzoquinone No suppilers available for the product. |
| Name | 2,5-Bis(4-Hydroxyphenyl)-1,4-Benzoquinone |
|---|---|
| Synonyms | 2,5-Bis(4-hydroxyphenyl)benzo-1,4-quinone #; AIDS017907 |
| Molecular Structure | ![]() |
| Molecular Formula | C18H12O4 |
| Molecular Weight | 292.29 |
| CAS Registry Number | 16688-88-3 |
| SMILES | O=C2/C=C(\C(=O)\C=C2\c1ccc(O)cc1)c3ccc(O)cc3 |
| InChI | 1S/C18H12O4/c19-13-5-1-11(2-6-13)15-9-18(22)16(10-17(15)21)12-3-7-14(20)8-4-12/h1-10,19-20H |
| InChIKey | ANAHUTWMJDYFGN-UHFFFAOYSA-N |
| Density | 1.41g/cm3 (Cal.) |
|---|---|
| Boiling point | 570.663°C at 760 mmHg (Cal.) |
| Flash point | 312.974°C (Cal.) |
| Refractive index | 1.696 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Bis(4-Hydroxyphenyl)-1,4-Benzoquinone |