|
CAS#: 16695-57-1 Product: 2,2-Dichloro-N,N-Diethyl-3-Oxobutyramide No suppilers available for the product. |
| Name | 2,2-Dichloro-N,N-Diethyl-3-Oxobutyramide |
|---|---|
| Synonyms | 2,2-Dichloro-N,N-Diethyl-3-Oxo-Butanamide; 2,2-Dichloro-N,N-Diethyl-3-Keto-Butyramide; 2,2-Dichloro-N,N-Diethyl-3-Oxobutyramide |
| Molecular Structure | ![]() |
| Molecular Formula | C8H13Cl2NO2 |
| Molecular Weight | 226.10 |
| CAS Registry Number | 16695-57-1 |
| EINECS | 240-744-5 |
| SMILES | C(C)N(C(C(C(C)=O)(Cl)Cl)=O)CC |
| InChI | 1S/C8H13Cl2NO2/c1-4-11(5-2)7(13)8(9,10)6(3)12/h4-5H2,1-3H3 |
| InChIKey | FDPMTHLEABSCPU-UHFFFAOYSA-N |
| Density | 1.223g/cm3 (Cal.) |
|---|---|
| Boiling point | 259.348°C at 760 mmHg (Cal.) |
| Flash point | 110.65°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dichloro-N,N-Diethyl-3-Oxobutyramide |