|
CAS#: 167073-68-9 Product: Methyl (2Z)-3-[(3S,5R)-5-Ethoxy-1,2-Dioxolan-3-Yl]Acrylate No suppilers available for the product. |
| Name | Methyl (2Z)-3-[(3S,5R)-5-Ethoxy-1,2-Dioxolan-3-Yl]Acrylate |
|---|---|
| Synonyms | (Z)-methyl 3-((3S,5R)-5-ethoxy-1,2-dioxolan-3-yl)acrylate |
| Molecular Structure | ![]() |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.20 |
| CAS Registry Number | 167073-68-9 |
| SMILES | CCO[C@H]1C[C@H](OO1)/C=C\C(=O)OC |
| InChI | 1S/C9H14O5/c1-3-12-9-6-7(13-14-9)4-5-8(10)11-2/h4-5,7,9H,3,6H2,1-2H3/b5-4-/t7-,9-/m1/s1 |
| InChIKey | QDQJKVIBXYFEKN-LEZDYHIDSA-N |
| Density | 1.151g/cm3 (Cal.) |
|---|---|
| Boiling point | 239.747°C at 760 mmHg (Cal.) |
| Flash point | 97.6°C (Cal.) |
| Refractive index | 1.466 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl (2Z)-3-[(3S,5R)-5-Ethoxy-1,2-Dioxolan-3-Yl]Acrylate |