|
CAS#: 16727-91-6 Product: 1-Isobutylnaphthalene No suppilers available for the product. |
| Name | 1-Isobutylnaphthalene |
|---|---|
| Synonyms | 1-Isobutylnaphthalene; Naphthalene, 1-(2-Methylpropyl)-; Naphthalene, 1-Isobutyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 |
| CAS Registry Number | 16727-91-6 |
| SMILES | C1=CC=C2C(=C1CC(C)C)C=CC=C2 |
| InChI | 1S/C14H16/c1-11(2)10-13-8-5-7-12-6-3-4-9-14(12)13/h3-9,11H,10H2,1-2H3 |
| InChIKey | ZYFTVCJVNRKBCC-UHFFFAOYSA-N |
| Density | 0.971g/cm3 (Cal.) |
|---|---|
| Boiling point | 286.335°C at 760 mmHg (Cal.) |
| Flash point | 127.464°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Isobutylnaphthalene |