Online Database of Chemicals from Around the World
|
CAS#: 16757-92-9 Product: 1,3,6-Trimethylbenzo[a]Pyrene No suppilers available for the product. |
| Name | 1,3,6-Trimethylbenzo[a]Pyrene |
|---|---|
| Synonyms | 1,3,6-Trimethylbenzo(A)Pyrene; 4-05-00-02708 (Beilstein Handbook Reference); Benzo(A)Pyrene, 1,3,6-Trimethyl- |
| Molecular Structure | ![CAS#: 16757-92-9, 1,3,6-Trimethylbenzo[a]Pyrene](/moreStructures/16757-92-9.gif) |
| Molecular Formula | C23H18 |
| Molecular Weight | 294.40 |
| CAS Registry Number | 16757-92-9 |
| SMILES | C1=CC4=C3C2=C1C5=C(C(=C2C=CC3=C(C=C4C)C)C)C=CC=C5 |
| InChI | 1S/C23H18/c1-13-12-14(2)17-9-11-21-20-7-5-4-6-18(20)15(3)19-10-8-16(13)22(17)23(19)21/h4-12H,1-3H3 |
| InChIKey | BZBLXOWOIQZQPM-UHFFFAOYSA-N |
| Density | 1.202g/cm3 (Cal.) |
|---|---|
| Boiling point | 503.144°C at 760 mmHg (Cal.) |
| Flash point | 253.012°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,3,6-Trimethylbenzo[a]Pyrene |