|
CAS#: 1677-64-1 Product: 2,6-Diethoxy-5-Methyl-3(2H)-Pyridazinone No suppilers available for the product. |
| Name | 2,6-Diethoxy-5-Methyl-3(2H)-Pyridazinone |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C9H14N2O3 |
| Molecular Weight | 198.22 |
| CAS Registry Number | 1677-64-1 |
| SMILES | O=C1/C=C(\C(\OCC)=N/N1OCC)C |
| InChI | 1S/C9H14N2O3/c1-4-13-9-7(3)6-8(12)11(10-9)14-5-2/h6H,4-5H2,1-3H3 |
| InChIKey | CECRSNJGEMQXJZ-UHFFFAOYSA-N |
| Density | 1.152g/cm3 (Cal.) |
|---|---|
| Boiling point | 250.444°C at 760 mmHg (Cal.) |
| Flash point | 105.265°C (Cal.) |
| Refractive index | 1.511 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,6-Diethoxy-5-Methyl-3(2H)-Pyridazinone |