|
CAS#: 16772-63-7 Product: Pereniporin B No suppilers available for the product. |
| Name | Pereniporin B |
|---|---|
| Synonyms | (5R,5As,9As,9Bs)-5,9B-Dihydroxy-6,6,9A-Trimethyl-1,5,5A,7,8,9-Hexahydrobenzo[E]Isobenzofuran-3-One; Naphtho(1,2-C)Furan-3(1H)-One, 5,5A,6,7,8,9,9A,9B-Octahydro-5,9B-Dihydroxy-6,6,9A-Trimethyl-, (5R-(5Alpha,5Abeta,9Aalpha,9Bbeta))-; Pereniporin B |
| Molecular Structure | ![]() |
| Molecular Formula | C15H22O4 |
| Molecular Weight | 266.34 |
| CAS Registry Number | 16772-63-7 |
| SMILES | [C@]12([C@H](C(CCC1)(C)C)[C@H](O)C=C3[C@]2(O)COC3=O)C |
| InChI | 1S/C15H22O4/c1-13(2)5-4-6-14(3)11(13)10(16)7-9-12(17)19-8-15(9,14)18/h7,10-11,16,18H,4-6,8H2,1-3H3/t10-,11+,14+,15-/m1/s1 |
| InChIKey | HLEGAPKZEJEXHT-FDRIWYBQSA-N |
| Density | 1.248g/cm3 (Cal.) |
|---|---|
| Boiling point | 463.027°C at 760 mmHg (Cal.) |
| Flash point | 173.413°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pereniporin B |