CAS#: 16790-41-3 Product: Fomecin B No suppilers available for the product. |
Name | Fomecin B |
---|---|
Synonyms | Fomecin B; 1,2-Benzenedicarboxaldehyde, 3,4,5-Trihydroxy- |
Molecular Structure | ![]() |
Molecular Formula | C8H6O5 |
Molecular Weight | 182.13 |
CAS Registry Number | 16790-41-3 |
SMILES | C1=C(C(=C(O)C(=C1O)O)C=O)C=O |
InChI | 1S/C8H6O5/c9-2-4-1-6(11)8(13)7(12)5(4)3-10/h1-3,11-13H |
InChIKey | BSOXVRQPIPFIDU-UHFFFAOYSA-N |
Density | 1.7±0.1g/cm3 (Cal.) |
---|---|
Boiling point | 351.8±42.0°C at 760 mmHg (Cal.) |
Flash point | 180.8±24.4°C (Cal.) |
Market Analysis Reports |
List of Reports Available for Fomecin B |