|
CAS#: 168127-35-3 Product: 2-[4-[2-(Phenylamino)-1,3-Thiazol-4-Yl]Phenoxy]Acetic Acid No suppilers available for the product. |
| Name | 2-[4-[2-(Phenylamino)-1,3-Thiazol-4-Yl]Phenoxy]Acetic Acid |
|---|---|
| Synonyms | 2-[4-[2-(Phenylamino)Thiazol-4-Yl]Phenoxy]Acetic Acid; 2-[4-[2-(Phenylamino)-4-Thiazolyl]Phenoxy]Acetic Acid; 2-[4-[2-(Phenylamino)-1,3-Thiazol-4-Yl]Phenoxy]Ethanoic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C17H14N2O3S |
| Molecular Weight | 326.37 |
| CAS Registry Number | 168127-35-3 |
| SMILES | C1=C(N=C(S1)NC2=CC=CC=C2)C3=CC=C(OCC(=O)O)C=C3 |
| InChI | 1S/C17H14N2O3S/c20-16(21)10-22-14-8-6-12(7-9-14)15-11-23-17(19-15)18-13-4-2-1-3-5-13/h1-9,11H,10H2,(H,18,19)(H,20,21) |
| InChIKey | WCSYUJTYBAYNLX-UHFFFAOYSA-N |
| Density | 1.368g/cm3 (Cal.) |
|---|---|
| Boiling point | 554.033°C at 760 mmHg (Cal.) |
| Flash point | 288.869°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[4-[2-(Phenylamino)-1,3-Thiazol-4-Yl]Phenoxy]Acetic Acid |