|
CAS#: 168399-38-0 Product: 1-[(2R,3S)-3-Isopropyl-2-Oxiranyl]-2-Methyl-1-Propanol No suppilers available for the product. |
| Name | 1-[(2R,3S)-3-Isopropyl-2-Oxiranyl]-2-Methyl-1-Propanol |
|---|---|
| Synonyms | 1-((2R,3S)-3-isopropyloxiran-2-yl)-2-methylpropan-1-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 |
| CAS Registry Number | 168399-38-0 |
| SMILES | CC(C)[C@H]1[C@H](O1)C(C(C)C)O |
| InChI | 1S/C9H18O2/c1-5(2)7(10)9-8(11-9)6(3)4/h5-10H,1-4H3/t7?,8-,9+/m0/s1 |
| InChIKey | NQKUHMCAOBVHQC-SXNZSPLWSA-N |
| Density | 0.971g/cm3 (Cal.) |
|---|---|
| Boiling point | 216.27°C at 760 mmHg (Cal.) |
| Flash point | 75.236°C (Cal.) |
| Refractive index | 1.461 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-[(2R,3S)-3-Isopropyl-2-Oxiranyl]-2-Methyl-1-Propanol |