|
CAS#: 16868-07-8 Product: Diphenyl Suberate No suppilers available for the product. |
| Name | Diphenyl Suberate |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 |
| CAS Registry Number | 16868-07-8 |
| SMILES | O=C(Oc1ccccc1)CCCCCCC(=O)Oc2ccccc2 |
| InChI | 1S/C20H22O4/c21-19(23-17-11-5-3-6-12-17)15-9-1-2-10-16-20(22)24-18-13-7-4-8-14-18/h3-8,11-14H,1-2,9-10,15-16H2 |
| InChIKey | NOPGQWZBTYTFAP-UHFFFAOYSA-N |
| Density | 1.119g/cm3 (Cal.) |
|---|---|
| Boiling point | 467.672°C at 760 mmHg (Cal.) |
| Flash point | 233.146°C (Cal.) |
| Refractive index | 1.541 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Diphenyl Suberate |