Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (650) 278-9963 | |||
|
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Name | 4-Nitrobenzyl N-[(Benzyloxy)Carbonyl]Threoninate |
|---|---|
| Synonyms | Z-THR-ONB |
| Molecular Structure | ![CAS#: 16879-84-8, 4-Nitrobenzyl N-[(Benzyloxy)Carbonyl]Threoninate](/moreStructures/16879-84-8.gif) |
| Molecular Formula | C19H20N2O7 |
| Molecular Weight | 388.37 |
| CAS Registry Number | 16879-84-8 |
| SMILES | CC(O)C(NC(=O)OCc1ccccc1)C(=O)OCc2ccc(cc2)[N+]([O-])=O |
| InChI | 1S/C19H20N2O7/c1-13(22)17(20-19(24)28-12-14-5-3-2-4-6-14)18(23)27-11-15-7-9-16(10-8-15)21(25)26/h2-10,13,17,22H,11-12H2,1H3,(H,20,24) |
| InChIKey | BYGUXNWBDJGIBM-UHFFFAOYSA-N |
| Density | 1.333g/cm3 (Cal.) |
|---|---|
| Boiling point | 601.04°C at 760 mmHg (Cal.) |
| Flash point | 317.298°C (Cal.) |
| Refractive index | 1.591 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Nitrobenzyl N-[(Benzyloxy)Carbonyl]Threoninate |