|
CAS#: 16897-87-3 Product: ({[(2S)-2-Methyl-3-Buten-1-Yl]Oxy}Methyl)Benzene No suppilers available for the product. |
| Name | ({[(2S)-2-Methyl-3-Buten-1-Yl]Oxy}Methyl)Benzene |
|---|---|
| Synonyms | (-)-(S)-(((2-Methylbut-3-en-1-yl)oxy)methyl)benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.25 |
| CAS Registry Number | 16897-87-3 |
| SMILES | O(C[C@H](\C=C)C)Cc1ccccc1 |
| InChI | 1S/C12H16O/c1-3-11(2)9-13-10-12-7-5-4-6-8-12/h3-8,11H,1,9-10H2,2H3/t11-/m0/s1 |
| InChIKey | VEDHRQABUYZICC-NSHDSACASA-N |
| Density | 0.927g/cm3 (Cal.) |
|---|---|
| Boiling point | 231.356°C at 760 mmHg (Cal.) |
| Flash point | 94.592°C (Cal.) |
| Refractive index | 1.498 (Cal.) |
| (1) | Perez et al.. Catalytic asymmetric carbon-carbon bond formation via allylic alkylations with organolithium compounds, Nature Chemistry, 2011 |
|---|---|
| Market Analysis Reports |
| List of Reports Available for ({[(2S)-2-Methyl-3-Buten-1-Yl]Oxy}Methyl)Benzene |