|
CAS#: 16910-33-1 Product: 24,28-Dihydroobtusifoliol No suppilers available for the product. |
| Name | 24,28-Dihydroobtusifoliol |
|---|---|
| Synonyms | (3S,4S,5S,10S,13R,17R)-4,10,13,14-Tetramethyl-17-[(1R,4S)-1,4,5-Trimethylhexyl]-1,2,3,4,5,6,7,11,12,15,16,17-Dodecahydrocyclopenta[A]Phenanthren-3-Ol; Ergost-8-En-3-Ol, 4,14-Dimethyl-, (3Beta,4Alpha,5Alpha)-; 24,28-Dihydroobtusifoliol |
| Molecular Structure | ![]() |
| Molecular Formula | C30H52O |
| Molecular Weight | 428.74 |
| CAS Registry Number | 16910-33-1 |
| SMILES | [C@]34(C(C1=C([C@@]2([C@@H](CC1)[C@@H]([C@@H](O)CC2)C)C)CC3)(CC[C@@H]4[C@@H](CC[C@@H](C(C)C)C)C)C)C |
| InChI | 1S/C30H52O/c1-19(2)20(3)9-10-21(4)23-13-17-30(8)26-12-11-24-22(5)27(31)15-16-28(24,6)25(26)14-18-29(23,30)7/h19-24,27,31H,9-18H2,1-8H3/t20-,21+,22-,23+,24-,27-,28-,29+,30?/m0/s1 |
| InChIKey | TVOLMEISVFEEJU-QZNGKTOYSA-N |
| Density | 0.974g/cm3 (Cal.) |
|---|---|
| Boiling point | 500.748°C at 760 mmHg (Cal.) |
| Flash point | 222.416°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 24,28-Dihydroobtusifoliol |