|
CAS#: 1692-54-2 Product: Dichloromethyl[3-(1,1,2,2-Tetrafluoroethoxy)Propyl]Silane No suppilers available for the product. |
| Name | Dichloromethyl[3-(1,1,2,2-Tetrafluoroethoxy)Propyl]Silane |
|---|---|
| Synonyms | Dichloromethyl(3-(1,1,2,2-Tetrafluoroethoxy)Propyl)Silane |
| Molecular Structure | ![]() |
| Molecular Formula | C6H10Cl2F4OSi |
| Molecular Weight | 273.13 |
| CAS Registry Number | 1692-54-2 |
| EINECS | 216-891-6 |
| SMILES | C([Si](Cl)(Cl)C)CCOC(C(F)F)(F)F |
| InChI | 1S/C6H10Cl2F4OSi/c1-14(7,8)4-2-3-13-6(11,12)5(9)10/h5H,2-4H2,1H3 |
| InChIKey | YDAPSIYKUYWNDG-UHFFFAOYSA-N |
| Density | 1.272g/cm3 (Cal.) |
|---|---|
| Boiling point | 165.369°C at 760 mmHg (Cal.) |
| Flash point | 53.814°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Dichloromethyl[3-(1,1,2,2-Tetrafluoroethoxy)Propyl]Silane |