|
CAS#: 16944-14-2 Product: N-((tert-Butoxy)carbonyl)-L-tyrosine compound with dicyclohexylamine (1:1) No suppilers available for the product. |
| Name | N-((tert-Butoxy)carbonyl)-L-tyrosine compound with dicyclohexylamine (1:1) |
|---|---|
| Synonyms | (2S)-2-(Tert-Butoxycarbonylamino)-3-(4-Hydroxyphenyl)Propanoic Acid; N-Cyclohexylcyclohexanamine; (2S)-2-[(Tert-Butoxy-Oxomethyl)Amino]-3-(4-Hydroxyphenyl)Propanoic Acid; N-Cyclohexylcyclohexanamine; (2S)-2-(Tert-Butoxycarbonylamino)-3-(4-Hydroxyphenyl)Propionic Acid; Dicyclohexylamine |
| Molecular Structure | ![]() |
| Molecular Formula | C26H42N2O5 |
| Molecular Weight | 462.63 |
| CAS Registry Number | 16944-14-2 |
| EINECS | 241-013-3 |
| SMILES | [C@H](NC(OC(C)(C)C)=O)(CC1=CC=C(O)C=C1)C(=O)O.C3C(NC2CCCCC2)CCCC3 |
| InChI | 1S/C14H19NO5.C12H23N/c1-14(2,3)20-13(19)15-11(12(17)18)8-9-4-6-10(16)7-5-9;1-3-7-11(8-4-1)13-12-9-5-2-6-10-12/h4-7,11,16H,8H2,1-3H3,(H,15,19)(H,17,18);11-13H,1-10H2/t11-;/m0./s1 |
| InChIKey | WLFHJXZLIRDBRG-MERQFXBCSA-N |
| Boiling point | 484.9°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 247.1°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-((tert-Butoxy)carbonyl)-L-tyrosine compound with dicyclohexylamine (1:1) |