|
CAS#: 1698-59-5 Product: 5-Amino-6-Chloro-2-Phenyl-3(2H)-Pyridazinone No suppilers available for the product. |
| Name | 5-Amino-6-Chloro-2-Phenyl-3(2H)-Pyridazinone |
|---|---|
| Synonyms | 5-Amino-6-Chloro-2-Phenyl-Pyridazin-3-One; 5-Amino-6-Chloro-2-Phenyl-3-Pyridazinone; 5-Amino-6-Chloro-2-Phenyl-3(2H)-Pyridazinone |
| Molecular Structure | ![]() |
| Molecular Formula | C10H8ClN3O |
| Molecular Weight | 221.65 |
| CAS Registry Number | 1698-59-5 |
| SMILES | C2=C(N1N=C(Cl)C(=CC1=O)N)C=CC=C2 |
| InChI | 1S/C10H8ClN3O/c11-10-8(12)6-9(15)14(13-10)7-4-2-1-3-5-7/h1-6H,12H2 |
| InChIKey | BDOCEPSNUBOONQ-UHFFFAOYSA-N |
| Density | 1.426g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.839°C at 760 mmHg (Cal.) |
| Flash point | 164.772°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Amino-6-Chloro-2-Phenyl-3(2H)-Pyridazinone |