|
CAS#: 16980-14-6 Product: 3,9,14-Triethyl-4,8,13,18-tetramethyl-3,4-didehydrophorbine No suppilers available for the product. |
| Name | 3,9,14-Triethyl-4,8,13,18-tetramethyl-3,4-didehydrophorbine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C32H36N4 |
| Molecular Weight | 476.65 |
| CAS Registry Number | 16980-14-6 |
| SMILES | CC\C2=C(/C)c1cc6nc(cc5nc(c4CCc3c4nc(cc2n1)c3C)C(\CC)=C5\C)c(C)c6CC |
| InChI | 1S/C32H36N4/c1-8-20-16(4)25-13-27-18(6)22(10-3)31(35-27)24-12-11-23-19(7)28(36-32(23)24)15-30-21(9-2)17(5)26(34-30)14-29(20)33-25/h13-15,33,36H,8-12H2,1-7H3/b25-13-,26-14-,27-13-,28-15-,29-14-,30-15-,31-24- |
| InChIKey | OSGJOZKEHQLENL-VPNWJWKESA-N |
| Density | 1.154g/cm3 (Cal.) |
|---|---|
| Boiling point | 824.757°C at 760 mmHg (Cal.) |
| Flash point | 355.485°C (Cal.) |
| Refractive index | 1.622 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,9,14-Triethyl-4,8,13,18-tetramethyl-3,4-didehydrophorbine |