|
CAS#: 17012-42-9 Product: O-Acetyl-L-Threonine No suppilers available for the product. |
| Name | O-Acetyl-L-Threonine |
|---|---|
| Synonyms | H-THR(AC)-OH |
| Molecular Structure | ![]() |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 |
| CAS Registry Number | 17012-42-9 |
| SMILES | O=C(O[C@@H]([C@H](N)C(=O)O)C)C |
| InChI | 1S/C6H11NO4/c1-3(11-4(2)8)5(7)6(9)10/h3,5H,7H2,1-2H3,(H,9,10)/t3-,5+/m1/s1 |
| InChIKey | GOVSRIMJZNIFHS-WUJLRWPWSA-N |
| Density | 1.239g/cm3 (Cal.) |
|---|---|
| Boiling point | 298.067°C at 760 mmHg (Cal.) |
| Flash point | 134.067°C (Cal.) |
| Refractive index | 1.475 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for O-Acetyl-L-Threonine |