|
CAS#: 170244-98-1 Product: 5-(Aminomethyl)-2-Naphthol No suppilers available for the product. |
| Name | 5-(Aminomethyl)-2-Naphthol |
|---|---|
| Synonyms | 1,2-ANTHRACENEDIOL,10-(AMINOMETHYL)-9,10-DIHYDRO-; 5-Aminomethyl-naphthalen-2-ol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 |
| CAS Registry Number | 170244-98-1 |
| SMILES | C1=CC2=C(C=CC(=C2)O)C(=C1)CN |
| InChI | 1S/C11H11NO/c12-7-9-3-1-2-8-6-10(13)4-5-11(8)9/h1-6,13H,7,12H2 |
| InChIKey | PFFJJFRURKJERG-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 371.2±17.0°C at 760 mmHg (Cal.) |
| Flash point | 178.3±20.9°C (Cal.) |
| Refractive index | 1.693 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-(Aminomethyl)-2-Naphthol |