|
CAS#: 170461-47-9 Product: 9-[(4-Nitrophenyl)Ethynyl]Anthracene No suppilers available for the product. |
| Name | 9-[(4-Nitrophenyl)Ethynyl]Anthracene |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C22H13NO2 |
| Molecular Weight | 323.34 |
| CAS Registry Number | 170461-47-9 |
| SMILES | [O-][N+](=O)c4ccc(C#Cc2c1ccccc1cc3ccccc23)cc4 |
| InChI | 1S/C22H13NO2/c24-23(25)19-12-9-16(10-13-19)11-14-22-20-7-3-1-5-17(20)15-18-6-2-4-8-21(18)22/h1-10,12-13,15H |
| InChIKey | STLIQNHVPOSJRJ-UHFFFAOYSA-N |
| Density | 1.321g/cm3 (Cal.) |
|---|---|
| Boiling point | 558.624°C at 760 mmHg (Cal.) |
| Flash point | 269.681°C (Cal.) |
| Refractive index | 1.751 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-[(4-Nitrophenyl)Ethynyl]Anthracene |