|
CAS#: 17058-53-6 Product: 2,5-Bis(Phenylthio)-1,4-Benzoquinone No suppilers available for the product. |
| Name | 2,5-Bis(Phenylthio)-1,4-Benzoquinone |
|---|---|
| Synonyms | 2,5-Bis(Phenylsulfanyl)-1,4-Benzoquinone; 2,5-Bis(Phenylthio)-1,4-Benzoquinone; 2,5-Bis(Phenylthio)-P-Benzoquinone |
| Molecular Structure | ![]() |
| Molecular Formula | C18H12O2S2 |
| Molecular Weight | 324.41 |
| CAS Registry Number | 17058-53-6 |
| SMILES | C3=C(SC1=CC(=O)C(=CC1=O)SC2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C18H12O2S2/c19-15-12-18(22-14-9-5-2-6-10-14)16(20)11-17(15)21-13-7-3-1-4-8-13/h1-12H |
| InChIKey | CQBMMTIVMOJHSO-UHFFFAOYSA-N |
| Density | 1.363g/cm3 (Cal.) |
|---|---|
| Boiling point | 483.205°C at 760 mmHg (Cal.) |
| Flash point | 209.092°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Bis(Phenylthio)-1,4-Benzoquinone |