|
CAS#: 170778-70-8 Product: N-[2-(2-Chloro-4,6-Dinitro-Phenyl)Azo-5-(Ethylamino)-4-Methoxy-Phenyl]Acetamide No suppilers available for the product. |
| Name | N-[2-(2-Chloro-4,6-Dinitro-Phenyl)Azo-5-(Ethylamino)-4-Methoxy-Phenyl]Acetamide |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C17H17ClN6O6 |
| Molecular Weight | 436.81 |
| CAS Registry Number | 170778-70-8 |
| SMILES | CCNc1cc(c(cc1OC)N=Nc2c(cc(cc2Cl)[N+](=O)[O-])[N+](=O)[O-])NC(=O)C |
| InChI | 1S/C17H17ClN6O6/c1-4-19-14-7-12(20-9(2)25)13(8-16(14)30-3)21-22-17-11(18)5-10(23(26)27)6-15(17)24(28)29/h5-8,19H,4H2,1-3H3,(H,20,25) |
| InChIKey | QXLFBJPUEXMTMJ-UHFFFAOYSA-N |
| Density | 1.511g/cm3 (Cal.) |
|---|---|
| Boiling point | 689.629°C at 760 mmHg (Cal.) |
| Flash point | 370.874°C (Cal.) |
| Refractive index | 1.651 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[2-(2-Chloro-4,6-Dinitro-Phenyl)Azo-5-(Ethylamino)-4-Methoxy-Phenyl]Acetamide |