Online Database of Chemicals from Around the World
|
CAS#: 17091-13-3 Product: D-Glucitol Hexanitrate No suppilers available for the product. |
| Name | D-Glucitol Hexanitrate |
|---|---|
| Synonyms | [1-(1,2-Dinitrooxyethyl)-2,3,4-Trinitrooxy-Butyl] Nitrate; Nitric Acid [1-(1,2-Dinitrooxyethyl)-2,3,4-Trinitrooxybutyl] Ester; Nitric Acid [1-(1,2-Dinitrooxyethyl)-2,3,4-Trinitrooxy-Butyl] Ester |
| Molecular Structure |  |
| Molecular Formula | C6H8N6O18 |
| Molecular Weight | 452.16 |
| CAS Registry Number | 17091-13-3 |
| EINECS | 241-156-1 |
| SMILES | C(O[N+]([O-])=O)C(O[N+]([O-])=O)C(O[N+]([O-])=O)C(O[N+]([O-])=O)C(O[N+]([O-])=O)CO[N+]([O-])=O |
| InChI | 1S/C6H8N6O18/c13-7(14)25-1-3(27-9(17)18)5(29-11(21)22)6(30-12(23)24)4(28-10(19)20)2-26-8(15)16/h3-6H,1-2H2 |
| InChIKey | DGMJZELBSFOPHH-UHFFFAOYSA-N |
| Density | 1.854g/cm3 (Cal.) |
|---|---|
| Boiling point | 537.12°C at 760 mmHg (Cal.) |
| Flash point | 232.358°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for D-Glucitol Hexanitrate |