|
CAS#: 17124-24-2 Product: N(6)-Methoxyadenine No suppilers available for the product. |
| Name | N(6)-Methoxyadenine |
|---|---|
| Synonyms | Methoxy-(7H-Purin-6-Yl)Amine; N6-Methoxyadenine; 1H-Purin-6-Amine, N-Methoxy- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H7N5O |
| Molecular Weight | 165.15 |
| CAS Registry Number | 17124-24-2 |
| SMILES | C2=NC1=C(C(=NC=N1)NOC)[NH]2 |
| InChI | 1S/C6H7N5O/c1-12-11-6-4-5(8-2-7-4)9-3-10-6/h2-3H,1H3,(H2,7,8,9,10,11) |
| InChIKey | HXTXFZYSIAHPTE-UHFFFAOYSA-N |
| Density | 1.538g/cm3 (Cal.) |
|---|---|
| Boiling point | 432.626°C at 760 mmHg (Cal.) |
| Flash point | 215.445°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N(6)-Methoxyadenine |