|
CAS#: 171336-81-5 Product: (2R,4R)-4-Amino-2,4-Pyrrolidinedicarboxylic Acid No suppilers available for the product. |
| Name | (2R,4R)-4-Amino-2,4-Pyrrolidinedicarboxylic Acid |
|---|---|
| Synonyms | (2R,4R)-4-Aminopyrrolidine-2,4-dicarboxylate; (2R,4R)-APDC; [169209-63-6] |
| Molecular Structure | ![]() |
| Molecular Formula | C6H10N2O4 |
| Molecular Weight | 174.15 |
| CAS Registry Number | 171336-81-5 |
| SMILES | C1[C@@H](NC[C@]1(C(=O)O)N)C(=O)O |
| InChI | 1S/C6H10N2O4/c7-6(5(11)12)1-3(4(9)10)8-2-6/h3,8H,1-2,7H2,(H,9,10)(H,11,12)/t3-,6-/m1/s1 |
| InChIKey | XZFMJVJDSYRWDQ-AWFVSMACSA-N |
| Density | 1.5±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 377.1±42.0°C at 760 mmHg (Cal.) |
| Flash point | 181.9±27.9°C (Cal.) |
| Refractive index | 1.564 (Cal.) |
| solubility | Soluble to 100 mM in water |
| Market Analysis Reports |
| List of Reports Available for (2R,4R)-4-Amino-2,4-Pyrrolidinedicarboxylic Acid |