|
CAS#: 17135-49-8 Product: 4'-Fluoro-4-(4-Fluorophenyl)Butyrophenone No suppilers available for the product. |
| Name | 4'-Fluoro-4-(4-Fluorophenyl)Butyrophenone |
|---|---|
| Synonyms | 4'-Fluoro-4-(4-Fluorophenyl)Butyrophenone |
| Molecular Structure | ![]() |
| Molecular Formula | C16H14F2O |
| Molecular Weight | 260.28 |
| CAS Registry Number | 17135-49-8 |
| EINECS | 241-193-3 |
| SMILES | C2=C(C(=O)CCCC1=CC=C(F)C=C1)C=CC(=C2)F |
| InChI | 1S/C16H14F2O/c17-14-8-4-12(5-9-14)2-1-3-16(19)13-6-10-15(18)11-7-13/h4-11H,1-3H2 |
| InChIKey | MWVYAXLUWZOOLT-UHFFFAOYSA-N |
| Density | 1.167g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.514°C at 760 mmHg (Cal.) |
| Flash point | 143.446°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Fluoro-4-(4-Fluorophenyl)Butyrophenone |