|
CAS#: 1714-50-7 Product: N-[Bis(4-Chlorophenyl)Methylene]Hydroxylamine No suppilers available for the product. |
| Name | N-[Bis(4-Chlorophenyl)Methylene]Hydroxylamine |
|---|---|
| Synonyms | Bis(4-Chlorophenyl)Methanone Oxime; Nsc65750; Aids018507 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9Cl2NO |
| Molecular Weight | 266.13 |
| CAS Registry Number | 1714-50-7 |
| SMILES | C2=C(C(=NO)C1=CC=C(Cl)C=C1)C=CC(=C2)Cl |
| InChI | 1S/C13H9Cl2NO/c14-11-5-1-9(2-6-11)13(16-17)10-3-7-12(15)8-4-10/h1-8,17H |
| InChIKey | NAXFZIAEWOZCSH-UHFFFAOYSA-N |
| Density | 1.295g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.423°C at 760 mmHg (Cal.) |
| Flash point | 188.712°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-[Bis(4-Chlorophenyl)Methylene]Hydroxylamine |