|
CAS#: 17158-48-4 Product: 9,9-Dimethyl-9-Silabicyclo[4.3.0]Nona-1,3,5-Triene No suppilers available for the product. |
| Name | 9,9-Dimethyl-9-Silabicyclo[4.3.0]Nona-1,3,5-Triene |
|---|---|
| Synonyms | 1-Silaindan, 1,1-Dimethyl-; 1H-1-Silaindene, 2,3-Dihydro-1,1-Dimethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14Si |
| Molecular Weight | 162.31 |
| CAS Registry Number | 17158-48-4 |
| SMILES | C1=CC=CC2=C1[Si](C)(C)CC2 |
| InChI | 1S/C10H14Si/c1-11(2)8-7-9-5-3-4-6-10(9)11/h3-6H,7-8H2,1-2H3 |
| InChIKey | MNIXUONHKSJMFL-UHFFFAOYSA-N |
| Density | 0.942g/cm3 (Cal.) |
|---|---|
| Boiling point | 200.254°C at 760 mmHg (Cal.) |
| Flash point | 60.221°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9,9-Dimethyl-9-Silabicyclo[4.3.0]Nona-1,3,5-Triene |