|
CAS#: 17165-86-5 Product: 9-(1,1'-Biphenyl)-4-Yl-9H-Fluorene No suppilers available for the product. |
| Name | 9-(1,1'-Biphenyl)-4-Yl-9H-Fluorene |
|---|---|
| Synonyms | 9-(1,1'-Biphenyl)-4-Yl-9H-Fluorene |
| Molecular Structure | ![]() |
| Molecular Formula | C25H18 |
| Molecular Weight | 318.42 |
| CAS Registry Number | 17165-86-5 |
| SMILES | C1=CC=CC2=C1C(C3=C2C=CC=C3)C5=CC=C(C4=CC=CC=C4)C=C5 |
| InChI | 1S/C25H18/c1-2-8-18(9-3-1)19-14-16-20(17-15-19)25-23-12-6-4-10-21(23)22-11-5-7-13-24(22)25/h1-17,25H |
| InChIKey | WREAKBMEDKBNRJ-UHFFFAOYSA-N |
| Density | 1.146g/cm3 (Cal.) |
|---|---|
| Boiling point | 481.597°C at 760 mmHg (Cal.) |
| Flash point | 241.52°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-(1,1'-Biphenyl)-4-Yl-9H-Fluorene |