|
CAS#: 17177-75-2 Product: Methyl trans-4-(2-Methyl-2-Propanyl)Cyclohexanecarboxylate No suppilers available for the product. |
| Name | Methyl trans-4-(2-Methyl-2-Propanyl)Cyclohexanecarboxylate |
|---|---|
| Synonyms | Methyl trans-4-tert.-butylcyclohexanecarboxylate; trans-4-( |
| Molecular Structure | ![]() |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.30 |
| CAS Registry Number | 17177-75-2 |
| SMILES | CC([C@H]1CC[C@@H](CC1)C(=O)OC)(C)C |
| InChI | 1S/C12H22O2/c1-12(2,3)10-7-5-9(6-8-10)11(13)14-4/h9-10H,5-8H2,1-4H3/t9-,10- |
| InChIKey | BWJSSYBIZVGKBG-MGCOHNPYSA-N |
| Density | 0.943g/cm3 (Cal.) |
|---|---|
| Boiling point | 222.215°C at 760 mmHg (Cal.) |
| Flash point | 90.841°C (Cal.) |
| Refractive index | 1.453 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Methyl trans-4-(2-Methyl-2-Propanyl)Cyclohexanecarboxylate |