Online Database of Chemicals from Around the World
|
CAS#: 17199-22-3 Product: 2-Bromo-6-Nitro-4-(1,1,3,3-Tetramethylbutyl)Phenol No suppilers available for the product. |
| Name | 2-Bromo-6-Nitro-4-(1,1,3,3-Tetramethylbutyl)Phenol |
|---|---|
| Synonyms | 2-Bromo-6-Nitro-4-(1,1,3,3-Tetramethylbutyl)Phenol; 2-Bromo-6-Nitro-4-(1,1,3,3-Tetramethylbutyl)-Ph* |
| Molecular Structure |  |
| Molecular Formula | C14H20BrNO3 |
| Molecular Weight | 330.22 |
| CAS Registry Number | 17199-22-3 |
| SMILES | C1=C(C(=C([N+]([O-])=O)C=C1C(C)(C)CC(C)(C)C)O)Br |
| InChI | 1S/C14H20BrNO3/c1-13(2,3)8-14(4,5)9-6-10(15)12(17)11(7-9)16(18)19/h6-7,17H,8H2,1-5H3 |
| InChIKey | RBDIWJZVNYIEMU-UHFFFAOYSA-N |
| Density | 1.328g/cm3 (Cal.) |
|---|---|
| Boiling point | 324.318°C at 760 mmHg (Cal.) |
| Flash point | 149.942°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Bromo-6-Nitro-4-(1,1,3,3-Tetramethylbutyl)Phenol |