|
CAS#: 17212-17-8 Product: 2-O-Methylrhamnose No suppilers available for the product. |
| Name | 2-O-Methylrhamnose |
|---|---|
| Synonyms | (2S,3S,4R,5R)-3,4,5-Trihydroxy-2-Methoxy-Hexanal; 2-Methylrhamnose; 2-O-Methyl-6-Deoxymannose |
| Molecular Structure | ![]() |
| Molecular Formula | C7H14O5 |
| Molecular Weight | 178.18 |
| CAS Registry Number | 17212-17-8 |
| SMILES | [C@@H](C=O)([C@H]([C@@H]([C@@H](C)O)O)O)OC |
| InChI | 1S/C7H14O5/c1-4(9)6(10)7(11)5(3-8)12-2/h3-7,9-11H,1-2H3/t4-,5-,6-,7-/m1/s1 |
| InChIKey | VCUILRLOJMHSMR-DBRKOABJSA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 386.841°C at 760 mmHg (Cal.) |
| Flash point | 159.687°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-O-Methylrhamnose |