|
CAS#: 17233-63-5 Product: 1,1,3,3-Tetramethyl-1,3-Bis(2-Phenylethyl)Disiloxane No suppilers available for the product. |
| Name | 1,1,3,3-Tetramethyl-1,3-Bis(2-Phenylethyl)Disiloxane |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C20H30OSi2 |
| Molecular Weight | 342.62 |
| CAS Registry Number | 17233-63-5 |
| SMILES | O([Si](CCc1ccccc1)(C)C)[Si](CCc2ccccc2)(C)C |
| InChI | 1S/C20H30OSi2/c1-22(2,17-15-19-11-7-5-8-12-19)21-23(3,4)18-16-20-13-9-6-10-14-20/h5-14H,15-18H2,1-4H3 |
| InChIKey | ICYXYVDMLIFAIN-UHFFFAOYSA-N |
| Density | 0.952g/cm3 (Cal.) |
|---|---|
| Boiling point | 375.807°C at 760 mmHg (Cal.) |
| Flash point | 150.757°C (Cal.) |
| Refractive index | 1.508 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,3,3-Tetramethyl-1,3-Bis(2-Phenylethyl)Disiloxane |