|
CAS#: 172462-90-7 Product: 2,8-Dimethyl-4-Quinazolinol No suppilers available for the product. |
| Name | 2,8-Dimethyl-4-Quinazolinol |
|---|---|
| Synonyms | 2,8-Dimethyl-3H-quinazolin-4-one; 2,8-Dimethylquinazolin-4(1H)-one |
| Molecular Structure | ![]() |
| Molecular Formula | C10H10N2O |
| Molecular Weight | 174.20 |
| CAS Registry Number | 172462-90-7 |
| SMILES | CC1=C2C(=CC=C1)C(=NC(=N2)C)O |
| InChI | 1S/C10H10N2O/c1-6-4-3-5-8-9(6)11-7(2)12-10(8)13/h3-5H,1-2H3,(H,11,12,13) |
| InChIKey | CJXMJXBJIWEHRP-UHFFFAOYSA-N |
| Density | 1.2±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 258.7±33.0°C at 760 mmHg (Cal.) |
| Flash point | 110.2±25.4°C (Cal.) |
| Refractive index | 1.656 (Cal.) |
| (1) | Xiaodong Zhang, Deju Ye, Haifeng Sun, Diliang Guo, Jiang Wang, He Huang, Xu Zhang, Hualiang Jiang and Hong Liu. Microwave-assisted synthesis of quinazolinone derivatives by efficient and rapid iron-catalyzed cyclization in water, Green Chem., 2009, 11, 1881. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2,8-Dimethyl-4-Quinazolinol |