|
CAS#: 17257-15-7 Product: trans-cis-Nepetalactone No suppilers available for the product. |
| Name | trans-cis-Nepetalactone |
|---|---|
| Synonyms | C09792; Nepetalactone Trans-Cis-Form; Lmpr01020115 |
| Molecular Structure | ![]() |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 |
| CAS Registry Number | 17257-15-7 |
| SMILES | [C@H]12[C@@H](C(=COC1=O)C)CC[C@@H]2C |
| InChI | 1S/C10H14O2/c1-6-3-4-8-7(2)5-12-10(11)9(6)8/h5-6,8-9H,3-4H2,1-2H3/t6-,8+,9-/m0/s1 |
| InChIKey | ZDKZHVNKFOXMND-ZQARSLAVSA-N |
| Density | 1.042g/cm3 (Cal.) |
|---|---|
| Boiling point | 270.601°C at 760 mmHg (Cal.) |
| Flash point | 107.736°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for trans-cis-Nepetalactone |