|
CAS#: 172753-09-2 Product: Ethyl (E)-2-[(4-Methylphenyl)Carbamoyl]-3-(Pyridin-4-Ylamino)Prop-2-Enoate No suppilers available for the product. |
| Name | Ethyl (E)-2-[(4-Methylphenyl)Carbamoyl]-3-(Pyridin-4-Ylamino)Prop-2-Enoate |
|---|---|
| Synonyms | Ethyl (E)-2-[(4-Methylphenyl)Carbamoyl]-3-(4-Pyridylamino)Prop-2-Enoate; (E)-2-[[(4-Methylphenyl)Amino]-Oxomethyl]-3-(4-Pyridylamino)Prop-2-Enoic Acid Ethyl Ester; (E)-2-[(4-Methylphenyl)Carbamoyl]-3-(4-Pyridylamino)Acrylic Acid Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C18H19N3O3 |
| Molecular Weight | 325.37 |
| CAS Registry Number | 172753-09-2 |
| SMILES | C2=C(NC(=O)\C(C(OCC)=O)=C/NC1=CC=NC=C1)C=CC(=C2)C |
| InChI | 1S/C18H19N3O3/c1-3-24-18(23)16(12-20-14-8-10-19-11-9-14)17(22)21-15-6-4-13(2)5-7-15/h4-12H,3H2,1-2H3,(H,19,20)(H,21,22)/b16-12+ |
| InChIKey | XZFCQLUYDJCJDR-FOWTUZBSSA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 540.909°C at 760 mmHg (Cal.) |
| Flash point | 280.932°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl (E)-2-[(4-Methylphenyl)Carbamoyl]-3-(Pyridin-4-Ylamino)Prop-2-Enoate |