|
CAS#: 17291-86-0 Product: (2,6-Dichlorophenethyl)Urea No suppilers available for the product. |
| Name | (2,6-Dichlorophenethyl)Urea |
|---|---|
| Synonyms | 2,6-Dichlorophenethylurea; Brn 2115606; Urea, 2,6-Dichlorophenethyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C9H10Cl2N2O |
| Molecular Weight | 233.10 |
| CAS Registry Number | 17291-86-0 |
| SMILES | C1=CC(=C(C(=C1)Cl)CCNC(=O)N)Cl |
| InChI | 1S/C9H10Cl2N2O/c10-7-2-1-3-8(11)6(7)4-5-13-9(12)14/h1-3H,4-5H2,(H3,12,13,14) |
| InChIKey | WHCIYAMCNYHKDJ-UHFFFAOYSA-N |
| Density | 1.353g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.164°C at 760 mmHg (Cal.) |
| Flash point | 171.622°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2,6-Dichlorophenethyl)Urea |