|
CAS#: 17306-02-4 Product: (E)-beta-Chloro-4'-Methylacrylophenone No suppilers available for the product. |
| Name | (E)-beta-Chloro-4'-Methylacrylophenone |
|---|---|
| Synonyms | 2-(4-Methylbenzoyl)Vinyl Chloride; 2-Propen-1-One, 3-Chloro-1-(4-Methylphenyl)- (9Ci); Acrylophenone, 3-Chloro-4'-Methyl-, (E)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H9ClO |
| Molecular Weight | 180.63 |
| CAS Registry Number | 17306-02-4 |
| SMILES | C1=CC(=CC=C1C)C(=O)\C=C\Cl |
| InChI | 1S/C10H9ClO/c1-8-2-4-9(5-3-8)10(12)6-7-11/h2-7H,1H3/b7-6+ |
| InChIKey | PXDDMPVNEGCENH-VOTSOKGWSA-N |
| Density | 1.138g/cm3 (Cal.) |
|---|---|
| Boiling point | 265.408°C at 760 mmHg (Cal.) |
| Flash point | 134.53°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (E)-beta-Chloro-4'-Methylacrylophenone |