Online Database of Chemicals from Around the World
|
CAS#: 1733-15-9 Product: Tetramethyl Ethylenetetracarboxylate No suppilers available for the product. |
| Name | Tetramethyl Ethylenetetracarboxylate |
|---|---|
| Synonyms | Zinc04257616; Nsc21377; Inchi=1/C10h12o8/C1-15-7(11)5(8(12)16-2)6(9(13)17-3)10(14)18-4/H1-4H |
| Molecular Structure |  |
| Molecular Formula | C10H12O8 |
| Molecular Weight | 260.20 |
| CAS Registry Number | 1733-15-9 |
| EINECS | 217-065-8 |
| SMILES | COC(C(=C(C(=O)OC)C(=O)OC)C(=O)OC)=O |
| InChI | 1S/C10H12O8/c1-15-7(11)5(8(12)16-2)6(9(13)17-3)10(14)18-4/h1-4H3 |
| InChIKey | NPBUMSUYCUWTSF-UHFFFAOYSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 252.101°C at 760 mmHg (Cal.) |
| Flash point | 101.862°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Tetramethyl Ethylenetetracarboxylate |